C10H18N2O — CID 117125627
N-propan-2-yl-2-(1,2,3,6-tetrahydropyridin-4-yl)acetamide (PubChem CID 117125627) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is N-propan-2-yl-2-(1,2,3,6-tetrahydropyridin-4-yl)acetamide.
| Compound Name | N-propan-2-yl-2-(1,2,3,6-tetrahydropyridin-4-yl)acetamide |
|---|---|
| PubChem CID | 117125627 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | N-propan-2-yl-2-(1,2,3,6-tetrahydropyridin-4-yl)acetamide |
| SMILES | CC(C)NC(=O)CC1=CCNCC1 |
| InChI | InChI=1S/C10H18N2O/c1-8(2)12-10(13)7-9-3-5-11-6-4-9/h3,8,11H,4-7H2,1-2H3,(H,12,13) |
| InChIKey | BZCZMLNZCJFKTR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|