C12H14N2O2 — CID 117133762
2-(oxolan-3-ylmethyl)-1H-imidazo[1,2-a]pyridin-7-one (PubChem CID 117133762) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-(oxolan-3-ylmethyl)-1H-imidazo[1,2-a]pyridin-7-one.
| Compound Name | 2-(oxolan-3-ylmethyl)-1H-imidazo[1,2-a]pyridin-7-one |
|---|---|
| PubChem CID | 117133762 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-(oxolan-3-ylmethyl)-1H-imidazo[1,2-a]pyridin-7-one |
| SMILES | O=c1ccn2cc(CC3CCOC3)[nH]c2c1 |
| InChI | InChI=1S/C12H14N2O2/c15-11-1-3-14-7-10(13-12(14)6-11)5-9-2-4-16-8-9/h1,3,6-7,9,13H,2,4-5,8H2 |
| InChIKey | LBKDBENKVXCHFI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |