C15H10O3S — CID 11715981
(2Z)-2-benzylidene-4,7-dihydroxy-1-benzothiophen-3-one (PubChem CID 11715981) has the molecular formula C15H10O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is (2Z)-2-benzylidene-4,7-dihydroxy-1-benzothiophen-3-one.
| Compound Name | (2Z)-2-benzylidene-4,7-dihydroxy-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 11715981 |
| Molecular Formula | C15H10O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | (2Z)-2-benzylidene-4,7-dihydroxy-1-benzothiophen-3-one |
| SMILES | O=C1/C(=C/c2ccccc2)Sc2c(O)ccc(O)c21 |
| InChI | InChI=1S/C15H10O3S/c16-10-6-7-11(17)15-13(10)14(18)12(19-15)8-9-4-2-1-3-5-9/h1-8,16-17H/b12-8- |
| InChIKey | OVRRNHAPYRWBNL-WQLSENKSSA-N |
| XLogP | 3.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|