C12H13F3N4 — CID 117167254
1-[3-[3-(trifluoromethyl)phenyl]triazol-4-yl]propan-2-amine (PubChem CID 117167254) has the molecular formula C12H13F3N4 and a molecular weight of 270.26 g/mol. Its IUPAC name is 1-[3-[3-(trifluoromethyl)phenyl]triazol-4-yl]propan-2-amine.
| Compound Name | 1-[3-[3-(trifluoromethyl)phenyl]triazol-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 117167254 |
| Molecular Formula | C12H13F3N4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1-[3-[3-(trifluoromethyl)phenyl]triazol-4-yl]propan-2-amine |
| SMILES | CC(N)Cc1cnnn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N4/c1-8(16)5-11-7-17-18-19(11)10-4-2-3-9(6-10)12(13,14)15/h2-4,6-8H,5,16H2,1H3 |
| InChIKey | OGWRKQLKEDAZRZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |