C9H7FO3S — CID 117183111
(7-fluoro-1,1-dioxo-1-benzothiophen-2-yl)methanol (PubChem CID 117183111) has the molecular formula C9H7FO3S and a molecular weight of 214.22 g/mol. Its IUPAC name is (7-fluoro-1,1-dioxo-1-benzothiophen-2-yl)methanol.
| Compound Name | (7-fluoro-1,1-dioxo-1-benzothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 117183111 |
| Molecular Formula | C9H7FO3S |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | (7-fluoro-1,1-dioxo-1-benzothiophen-2-yl)methanol |
| SMILES | O=S1(=O)C(CO)=Cc2cccc(F)c21 |
| InChI | InChI=1S/C9H7FO3S/c10-8-3-1-2-6-4-7(5-11)14(12,13)9(6)8/h1-4,11H,5H2 |
| InChIKey | DKRFFWCWBGTEQS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |