C11H11NO4S — CID 117192455
5-[(2-methoxyphenoxy)methyl]-1,3-thiazole 1,1-dioxide (PubChem CID 117192455) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is 5-[(2-methoxyphenoxy)methyl]-1,3-thiazole 1,1-dioxide.
| Compound Name | 5-[(2-methoxyphenoxy)methyl]-1,3-thiazole 1,1-dioxide |
|---|---|
| PubChem CID | 117192455 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 5-[(2-methoxyphenoxy)methyl]-1,3-thiazole 1,1-dioxide |
| SMILES | COc1ccccc1OCC1=CN=CS1(=O)=O |
| InChI | InChI=1S/C11H11NO4S/c1-15-10-4-2-3-5-11(10)16-7-9-6-12-8-17(9,13)14/h2-6,8H,7H2,1H3 |
| InChIKey | VVTCFYZOPBSILN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |