C10H10ClNO2 — CID 117193289
4-chloro-2-methyl-1,3-dihydroindole-2-carboxylic acid (PubChem CID 117193289) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is 4-chloro-2-methyl-1,3-dihydroindole-2-carboxylic acid.
| Compound Name | 4-chloro-2-methyl-1,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 117193289 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 4-chloro-2-methyl-1,3-dihydroindole-2-carboxylic acid |
| SMILES | CC1(C(=O)O)Cc2c(Cl)cccc2N1 |
| InChI | InChI=1S/C10H10ClNO2/c1-10(9(13)14)5-6-7(11)3-2-4-8(6)12-10/h2-4,12H,5H2,1H3,(H,13,14) |
| InChIKey | HCYGEEPRGDFHIG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |