C12H15NO2 — CID 117205414
3-[(3-methoxyphenoxy)methyl]-2,5-dihydro-1H-pyrrole (PubChem CID 117205414) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-[(3-methoxyphenoxy)methyl]-2,5-dihydro-1H-pyrrole.
| Compound Name | 3-[(3-methoxyphenoxy)methyl]-2,5-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 117205414 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-[(3-methoxyphenoxy)methyl]-2,5-dihydro-1H-pyrrole |
| SMILES | COc1cccc(OCC2=CCNC2)c1 |
| InChI | InChI=1S/C12H15NO2/c1-14-11-3-2-4-12(7-11)15-9-10-5-6-13-8-10/h2-5,7,13H,6,8-9H2,1H3 |
| InChIKey | USJHRWOKZDJOQI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|