C7H12N2O4S2 — CID 117216950
1,1-dioxo-5-(propan-2-ylsulfonylmethyl)-1,2-thiazol-3-amine (PubChem CID 117216950) has the molecular formula C7H12N2O4S2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 1,1-dioxo-5-(propan-2-ylsulfonylmethyl)-1,2-thiazol-3-amine.
| Compound Name | 1,1-dioxo-5-(propan-2-ylsulfonylmethyl)-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 117216950 |
| Molecular Formula | C7H12N2O4S2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 1,1-dioxo-5-(propan-2-ylsulfonylmethyl)-1,2-thiazol-3-amine |
| SMILES | CC(C)S(=O)(=O)CC1=CC(N)=NS1(=O)=O |
| InChI | InChI=1S/C7H12N2O4S2/c1-5(2)14(10,11)4-6-3-7(8)9-15(6,12)13/h3,5H,4H2,1-2H3,(H2,8,9) |
| InChIKey | RVWRBMUDTRUAIJ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |