C4H7N3O — CID 117217402
5-(aminomethyl)-1,2-oxazol-4-amine (PubChem CID 117217402) has the molecular formula C4H7N3O and a molecular weight of 113.12 g/mol. Its IUPAC name is 5-(aminomethyl)-1,2-oxazol-4-amine.
| Compound Name | 5-(aminomethyl)-1,2-oxazol-4-amine |
|---|---|
| PubChem CID | 117217402 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 5-(aminomethyl)-1,2-oxazol-4-amine |
| SMILES | NCc1oncc1N |
| InChI | InChI=1S/C4H7N3O/c5-1-4-3(6)2-7-8-4/h2H,1,5-6H2 |
| InChIKey | FWHZBHVMMAEGOT-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |