About 5-(aminomethyl)-1,2-oxazol-4-amine
5-(aminomethyl)-1,2-oxazol-4-amine (PubChem CID 117217402) has the molecular formula C4H7N3O
and a molecular weight of 113.12 g/mol. Its IUPAC name is 5-(aminomethyl)-1,2-oxazol-4-amine.
Molecular Properties
| Compound Name | 5-(aminomethyl)-1,2-oxazol-4-amine |
| PubChem CID | 117217402 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 5-(aminomethyl)-1,2-oxazol-4-amine |
| SMILES | NCc1oncc1N |
| InChI | InChI=1S/C4H7N3O/c5-1-4-3(6)2-7-8-4/h2H,1,5-6H2 |
| InChIKey | FWHZBHVMMAEGOT-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(aminomethyl)-1,2-oxazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-1,2-oxazol-4-amine?
The IUPAC name of 5-(aminomethyl)-1,2-oxazol-4-amine (CID 117217402) is 5-(aminomethyl)-1,2-oxazol-4-amine.
What is the SMILES notation for 5-(aminomethyl)-1,2-oxazol-4-amine?
The canonical SMILES for 5-(aminomethyl)-1,2-oxazol-4-amine is NCc1oncc1N.
What is the InChIKey of 5-(aminomethyl)-1,2-oxazol-4-amine?
The InChIKey is FWHZBHVMMAEGOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O/c5-1-4-3(6)2-7-8-4/h2H,1,5-6H2.
What are the key properties of 5-(aminomethyl)-1,2-oxazol-4-amine?
5-(aminomethyl)-1,2-oxazol-4-amine has a molecular weight of 113.12 g/mol, XLogP of -0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-1,2-oxazol-4-amine is sourced from PubChem (CID 117217402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).