C46H28N2O8 — CID 11721827
(2,5-dioxopyrrol-1-yl) 3-[4-[2-[6-[2-[4-[3-(2,5-dioxopyrrol-1-yl)oxy-3-oxopropyl]phenyl]ethynyl]pyren-1-yl]ethynyl]phenyl]propanoate (PubChem CID 11721827) has the molecular formula C46H28N2O8 and a molecular weight of 736.74 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) 3-[4-[2-[6-[2-[4-[3-(2,5-dioxopyrrol-1-yl)oxy-3-oxopropyl]phenyl]ethynyl]pyren-1-yl]ethynyl]phenyl]propanoate.
| Compound Name | (2,5-dioxopyrrol-1-yl) 3-[4-[2-[6-[2-[4-[3-(2,5-dioxopyrrol-1-yl)oxy-3-oxopropyl]phenyl]ethynyl]pyren-1-yl]ethynyl]phenyl]propanoate |
|---|---|
| PubChem CID | 11721827 |
| Molecular Formula | C46H28N2O8 |
| Molecular Weight | 736.74 g/mol |
| Exact Mass | 736.18 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) 3-[4-[2-[6-[2-[4-[3-(2,5-dioxopyrrol-1-yl)oxy-3-oxopropyl]phenyl]ethynyl]pyren-1-yl]ethynyl]phenyl]propanoate |
| SMILES | O=C(CCc1ccc(C#Cc2ccc3ccc4c(C#Cc5ccc(CCC(=O)ON6C(=O)C=CC6=O)cc5)ccc5ccc2c3c54)cc1)ON1C(=O)C=CC1=O |
| InChI | InChI=1S/C46H28N2O8/c49-39-23-24-40(50)47(39)55-43(53)27-11-31-5-1-29(2-6-31)9-13-33-15-17-35-20-22-38-34(16-18-36-19-21-37(33)45(35)46(36)38)14-10-30-3-7-32(8-4-30)12-28-44(54)56-48-41(51)25-26-42(48)52/h1-8,15-26H,11-12,27-28H2 |
| InChIKey | BLNMPWBEURDZBY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.74 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|