C30H27O5P — CID 102136776
[1-methoxy-3-[[4-(2-pyren-1-ylethynyl)phenyl]methoxy]propan-2-yl]oxy-methylphosphinic acid (PubChem CID 102136776) has the molecular formula C30H27O5P and a molecular weight of 498.52 g/mol. Its IUPAC name is [1-methoxy-3-[[4-(2-pyren-1-ylethynyl)phenyl]methoxy]propan-2-yl]oxy-methylphosphinic acid.
| Compound Name | [1-methoxy-3-[[4-(2-pyren-1-ylethynyl)phenyl]methoxy]propan-2-yl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 102136776 |
| Molecular Formula | C30H27O5P |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [1-methoxy-3-[[4-(2-pyren-1-ylethynyl)phenyl]methoxy]propan-2-yl]oxy-methylphosphinic acid |
| SMILES | COCC(COCc1ccc(C#Cc2ccc3ccc4cccc5ccc2c3c45)cc1)OP(C)(=O)O |
| InChI | InChI=1S/C30H27O5P/c1-33-19-27(35-36(2,31)32)20-34-18-22-8-6-21(7-9-22)10-11-23-12-13-26-15-14-24-4-3-5-25-16-17-28(23)30(26)29(24)25/h3-9,12-17,27H,18-20H2,1-2H3,(H,31,32) |
| InChIKey | JBPXKDUAFJGLRQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|