C49H40O5 — CID 87766229
(2S)-2-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[[4-(2-pyren-1-ylethynyl)phenyl]methoxy]propan-1-ol (PubChem CID 87766229) has the molecular formula C49H40O5 and a molecular weight of 708.85 g/mol. Its IUPAC name is (2S)-2-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[[4-(2-pyren-1-ylethynyl)phenyl]methoxy]propan-1-ol.
| Compound Name | (2S)-2-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[[4-(2-pyren-1-ylethynyl)phenyl]methoxy]propan-1-ol |
|---|---|
| PubChem CID | 87766229 |
| Molecular Formula | C49H40O5 |
| Molecular Weight | 708.85 g/mol |
| Exact Mass | 708.29 |
| IUPAC Name | (2S)-2-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[[4-(2-pyren-1-ylethynyl)phenyl]methoxy]propan-1-ol |
| SMILES | COc1ccc(C(O[C@@H](CO)COCc2ccc(C#Cc3ccc4ccc5cccc6ccc3c4c56)cc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C49H40O5/c1-51-43-26-22-41(23-27-43)49(40-9-4-3-5-10-40,42-24-28-44(52-2)29-25-42)54-45(31-50)33-53-32-35-13-11-34(12-14-35)15-16-36-17-18-39-20-19-37-7-6-8-38-21-30-46(36)48(39)47(37)38/h3-14,17-30,45,50H,31-33H2,1-2H3/t45-/m0/s1 |
| InChIKey | LYZOKTIXTJYVHR-GWHBCOKCSA-N |
| XLogP | 9.89 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.85 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|