C34H46O3 — CID 161050908
2,3-dimethoxypropoxymethylbenzene;ethane;pyrene (PubChem CID 161050908) has the molecular formula C34H46O3 and a molecular weight of 502.74 g/mol. Its IUPAC name is 2,3-dimethoxypropoxymethylbenzene;ethane;pyrene.
| Compound Name | 2,3-dimethoxypropoxymethylbenzene;ethane;pyrene |
|---|---|
| PubChem CID | 161050908 |
| Molecular Formula | C34H46O3 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | 2,3-dimethoxypropoxymethylbenzene;ethane;pyrene |
| SMILES | CC.CC.CC.COCC(COCc1ccccc1)OC.c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.C12H18O3.3C2H6/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-13-9-12(14-2)10-15-8-11-6-4-3-5-7-11;3*1-2/h1-10H;3-7,12H,8-10H2,1-2H3;3*1-2H3 |
| InChIKey | UCCWYKAADCTBAU-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|