C26H27O6P — CID 101411404
[(2R)-1-methoxy-3-[[3-[2-(4-phenylphenyl)ethynyl]phenyl]methoxy]propan-2-yl] methyl hydrogen phosphate (PubChem CID 101411404) has the molecular formula C26H27O6P and a molecular weight of 466.47 g/mol. Its IUPAC name is [(2R)-1-methoxy-3-[[3-[2-(4-phenylphenyl)ethynyl]phenyl]methoxy]propan-2-yl] methyl hydrogen phosphate.
| Compound Name | [(2R)-1-methoxy-3-[[3-[2-(4-phenylphenyl)ethynyl]phenyl]methoxy]propan-2-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 101411404 |
| Molecular Formula | C26H27O6P |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | [(2R)-1-methoxy-3-[[3-[2-(4-phenylphenyl)ethynyl]phenyl]methoxy]propan-2-yl] methyl hydrogen phosphate |
| SMILES | COC[C@H](COCc1cccc(C#Cc2ccc(-c3ccccc3)cc2)c1)OP(=O)(O)OC |
| InChI | InChI=1S/C26H27O6P/c1-29-19-26(32-33(27,28)30-2)20-31-18-23-8-6-7-22(17-23)12-11-21-13-15-25(16-14-21)24-9-4-3-5-10-24/h3-10,13-17,26H,18-20H2,1-2H3,(H,27,28)/t26-/m1/s1 |
| InChIKey | CNQRSOUNYCNFBJ-AREMUKBSSA-N |
| XLogP | 5.05 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|