C20H27NO3 — CID 11724134
(1R,2R,3R,4S,7S)-7-tert-butyl-1-methyl-3-(phenylmethoxymethyl)-9-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one (PubChem CID 11724134) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (1R,2R,3R,4S,7S)-7-tert-butyl-1-methyl-3-(phenylmethoxymethyl)-9-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one.
| Compound Name | (1R,2R,3R,4S,7S)-7-tert-butyl-1-methyl-3-(phenylmethoxymethyl)-9-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one |
|---|---|
| PubChem CID | 11724134 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (1R,2R,3R,4S,7S)-7-tert-butyl-1-methyl-3-(phenylmethoxymethyl)-9-oxa-6-azatricyclo[4.3.0.02,4]nonan-5-one |
| SMILES | CC(C)(C)[C@H]1CO[C@]2(C)[C@@H]3[C@@H](COCc4ccccc4)[C@@H]3C(=O)N12 |
| InChI | InChI=1S/C20H27NO3/c1-19(2,3)15-12-24-20(4)17-14(16(17)18(22)21(15)20)11-23-10-13-8-6-5-7-9-13/h5-9,14-17H,10-12H2,1-4H3/t14-,15+,16-,17+,20+/m0/s1 |
| InChIKey | XAEPOGACKSKFEM-TWGXZMITSA-N |
| XLogP | 3.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |