C20H30O2S — CID 11724462
2-(1-hydroxyoctyl)-3-phenylsulfanylcyclohexan-1-one (PubChem CID 11724462) has the molecular formula C20H30O2S and a molecular weight of 334.52 g/mol. Its IUPAC name is 2-(1-hydroxyoctyl)-3-phenylsulfanylcyclohexan-1-one.
| Compound Name | 2-(1-hydroxyoctyl)-3-phenylsulfanylcyclohexan-1-one |
|---|---|
| PubChem CID | 11724462 |
| Molecular Formula | C20H30O2S |
| Molecular Weight | 334.52 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-(1-hydroxyoctyl)-3-phenylsulfanylcyclohexan-1-one |
| SMILES | CCCCCCCC(O)C1C(=O)CCCC1Sc1ccccc1 |
| InChI | InChI=1S/C20H30O2S/c1-2-3-4-5-9-13-17(21)20-18(22)14-10-15-19(20)23-16-11-7-6-8-12-16/h6-8,11-12,17,19-21H,2-5,9-10,13-15H2,1H3 |
| InChIKey | XHSDLEUKDYTQJC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|