C12H7FN2O2S — CID 117261558
7-fluoro-3-thiophen-2-yl-1H-quinazoline-2,4-dione (PubChem CID 117261558) has the molecular formula C12H7FN2O2S and a molecular weight of 262.26 g/mol. Its IUPAC name is 7-fluoro-3-thiophen-2-yl-1H-quinazoline-2,4-dione.
| Compound Name | 7-fluoro-3-thiophen-2-yl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117261558 |
| Molecular Formula | C12H7FN2O2S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 7-fluoro-3-thiophen-2-yl-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cc(F)ccc2c(=O)n1-c1cccs1 |
| InChI | InChI=1S/C12H7FN2O2S/c13-7-3-4-8-9(6-7)14-12(17)15(11(8)16)10-2-1-5-18-10/h1-6H,(H,14,17) |
| InChIKey | VPPCSHHKXBOYLZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |