C11H16Br2N2O2 — CID 117274749
2,5-bis(2-aminoethyl)-3,6-dibromo-4-methoxyphenol (PubChem CID 117274749) has the molecular formula C11H16Br2N2O2 and a molecular weight of 368.07 g/mol. Its IUPAC name is 2,5-bis(2-aminoethyl)-3,6-dibromo-4-methoxyphenol.
| Compound Name | 2,5-bis(2-aminoethyl)-3,6-dibromo-4-methoxyphenol |
|---|---|
| PubChem CID | 117274749 |
| Molecular Formula | C11H16Br2N2O2 |
| Molecular Weight | 368.07 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 2,5-bis(2-aminoethyl)-3,6-dibromo-4-methoxyphenol |
| SMILES | COc1c(Br)c(CCN)c(O)c(Br)c1CCN |
| InChI | InChI=1S/C11H16Br2N2O2/c1-17-11-7(3-5-15)8(12)10(16)6(2-4-14)9(11)13/h16H,2-5,14-15H2,1H3 |
| InChIKey | FXWFQHNDUDSCJC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.07 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |