C20H22O3S — CID 11727599
methyl (Z,5S)-5-hydroxy-7-phenyl-7-phenylsulfanylhept-2-enoate (PubChem CID 11727599) has the molecular formula C20H22O3S and a molecular weight of 342.46 g/mol. Its IUPAC name is methyl (Z,5S)-5-hydroxy-7-phenyl-7-phenylsulfanylhept-2-enoate.
| Compound Name | methyl (Z,5S)-5-hydroxy-7-phenyl-7-phenylsulfanylhept-2-enoate |
|---|---|
| PubChem CID | 11727599 |
| Molecular Formula | C20H22O3S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | methyl (Z,5S)-5-hydroxy-7-phenyl-7-phenylsulfanylhept-2-enoate |
| SMILES | COC(=O)/C=C\C[C@H](O)CC(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22O3S/c1-23-20(22)14-8-11-17(21)15-19(16-9-4-2-5-10-16)24-18-12-6-3-7-13-18/h2-10,12-14,17,19,21H,11,15H2,1H3/b14-8-/t17-,19?/m0/s1 |
| InChIKey | RLTXVJIIANRVME-WTDQPEIMSA-N |
| XLogP | 4.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|