About 6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile
6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile (PubChem CID 117284926) has the molecular formula C9H6FNO3
and a molecular weight of 195.15 g/mol. Its IUPAC name is 6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile.
Molecular Properties
| Compound Name | 6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile |
| PubChem CID | 117284926 |
| Molecular Formula | C9H6FNO3 |
| Molecular Weight | 195.15 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile |
| SMILES | N#Cc1c(F)c(O)cc2c1OCCO2 |
| InChI | InChI=1S/C9H6FNO3/c10-8-5(4-11)9-7(3-6(8)12)13-1-2-14-9/h3,12H,1-2H2 |
| InChIKey | HWJDIWZIFCFPDT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.15 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile?
The IUPAC name of 6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile (CID 117284926) is 6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile.
What is the SMILES notation for 6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile?
The canonical SMILES for 6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile is N#Cc1c(F)c(O)cc2c1OCCO2.
What is the InChIKey of 6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile?
The InChIKey is HWJDIWZIFCFPDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNO3/c10-8-5(4-11)9-7(3-6(8)12)13-1-2-14-9/h3,12H,1-2H2.
What are the key properties of 6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile?
6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile has a molecular weight of 195.15 g/mol, XLogP of 1.17, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-7-hydroxy-2,3-dihydro-1,4-benzodioxine-5-carbonitrile is sourced from PubChem (CID 117284926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).