C11H13F2N — CID 117286859
(E)-3-(5-ethyl-2,3-difluorophenyl)prop-2-en-1-amine (PubChem CID 117286859) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is (E)-3-(5-ethyl-2,3-difluorophenyl)prop-2-en-1-amine.
| Compound Name | (E)-3-(5-ethyl-2,3-difluorophenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 117286859 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (E)-3-(5-ethyl-2,3-difluorophenyl)prop-2-en-1-amine |
| SMILES | CCc1cc(F)c(F)c(/C=C/CN)c1 |
| InChI | InChI=1S/C11H13F2N/c1-2-8-6-9(4-3-5-14)11(13)10(12)7-8/h3-4,6-7H,2,5,14H2,1H3/b4-3+ |
| InChIKey | WHXLVYZDVATDGU-ONEGZZNKSA-N |
| XLogP | 2.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |