C22H38O3SSi — CID 11732355
[(1R,2S)-2-(benzenesulfonylmethyl)cyclohexyl]oxy-tri(propan-2-yl)silane (PubChem CID 11732355) has the molecular formula C22H38O3SSi and a molecular weight of 410.70 g/mol. Its IUPAC name is [(1R,2S)-2-(benzenesulfonylmethyl)cyclohexyl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1R,2S)-2-(benzenesulfonylmethyl)cyclohexyl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11732355 |
| Molecular Formula | C22H38O3SSi |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | [(1R,2S)-2-(benzenesulfonylmethyl)cyclohexyl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@@H]1CCCC[C@@H]1CS(=O)(=O)c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H38O3SSi/c1-17(2)27(18(3)4,19(5)6)25-22-15-11-10-12-20(22)16-26(23,24)21-13-8-7-9-14-21/h7-9,13-14,17-20,22H,10-12,15-16H2,1-6H3/t20-,22-/m1/s1 |
| InChIKey | CTUATOWHMQSRBC-IFMALSPDSA-N |
| XLogP | 6.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|