C22H32N2O6 — CID 11732555
tert-butyl N-[(2S)-1-oxo-3-(5-oxo-2,3-dihydro-1,4-benzodioxepin-7-yl)-1-(pentylamino)propan-2-yl]carbamate (PubChem CID 11732555) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-3-(5-oxo-2,3-dihydro-1,4-benzodioxepin-7-yl)-1-(pentylamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-oxo-3-(5-oxo-2,3-dihydro-1,4-benzodioxepin-7-yl)-1-(pentylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 11732555 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-3-(5-oxo-2,3-dihydro-1,4-benzodioxepin-7-yl)-1-(pentylamino)propan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)[C@H](Cc1ccc2c(c1)C(=O)OCCO2)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H32N2O6/c1-5-6-7-10-23-19(25)17(24-21(27)30-22(2,3)4)14-15-8-9-18-16(13-15)20(26)29-12-11-28-18/h8-9,13,17H,5-7,10-12,14H2,1-4H3,(H,23,25)(H,24,27)/t17-/m0/s1 |
| InChIKey | NZPLEKPZJBSWLU-KRWDZBQOSA-N |
| XLogP | 2.98 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|