C8H12F6O6S4 — CID 11733002
[5-(trifluoromethylsulfonyloxy)-1λ4,5λ4-dithiabicyclo[3.3.0]octan-1-yl] trifluoromethanesulfonate (PubChem CID 11733002) has the molecular formula C8H12F6O6S4 and a molecular weight of 446.43 g/mol. Its IUPAC name is [5-(trifluoromethylsulfonyloxy)-1λ4,5λ4-dithiabicyclo[3.3.0]octan-1-yl] trifluoromethanesulfonate.
| Compound Name | [5-(trifluoromethylsulfonyloxy)-1λ4,5λ4-dithiabicyclo[3.3.0]octan-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11733002 |
| Molecular Formula | C8H12F6O6S4 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 445.94 |
| IUPAC Name | [5-(trifluoromethylsulfonyloxy)-1λ4,5λ4-dithiabicyclo[3.3.0]octan-1-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OS12CCCS1(OS(=O)(=O)C(F)(F)F)CCC2)C(F)(F)F |
| InChI | InChI=1S/C8H12F6O6S4/c9-7(10,11)23(15,16)19-21-3-1-4-22(21,6-2-5-21)20-24(17,18)8(12,13)14/h1-6H2 |
| InChIKey | USEPCFCNPQJNQZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|