C10H16F6O6S4 — CID 134882239
[1-[1-(trifluoromethylsulfonyloxy)thiolan-1-yl]thiolan-1-yl] trifluoromethanesulfonate (PubChem CID 134882239) has the molecular formula C10H16F6O6S4 and a molecular weight of 474.49 g/mol. Its IUPAC name is [1-[1-(trifluoromethylsulfonyloxy)thiolan-1-yl]thiolan-1-yl] trifluoromethanesulfonate.
| Compound Name | [1-[1-(trifluoromethylsulfonyloxy)thiolan-1-yl]thiolan-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134882239 |
| Molecular Formula | C10H16F6O6S4 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 473.97 |
| IUPAC Name | [1-[1-(trifluoromethylsulfonyloxy)thiolan-1-yl]thiolan-1-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OS1(S2(OS(=O)(=O)C(F)(F)F)CCCC2)CCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H16F6O6S4/c11-9(12,13)25(17,18)21-23(5-1-2-6-23)24(7-3-4-8-24)22-26(19,20)10(14,15)16/h1-8H2 |
| InChIKey | BXCMPOZZCGJHPS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|