About 1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate
1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate (PubChem CID 139091438) has the molecular formula C8H12F6O6S3Te
and a molecular weight of 541.97 g/mol. Its IUPAC name is 1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate |
| PubChem CID | 139091438 |
| Molecular Formula | C8H12F6O6S3Te |
| Molecular Weight | 541.97 g/mol |
| Exact Mass | 543.88 |
| IUPAC Name | 1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate |
| SMILES | O=S(=O)(O[Te]12CCC[S+]1CCC2)C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C7H12F3O3S2Te.CHF3O3S/c8-7(9,10)15(11,12)13-16-5-1-3-14(16)4-2-6-16;2-1(3,4)8(5,6)7/h1-6H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | TWPOFMTVQFJVCG-UHFFFAOYSA-M |
| XLogP | 1.77 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 541.97 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate?
The IUPAC name of 1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate (CID 139091438) is 1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate.
What is the SMILES notation for 1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate?
The canonical SMILES for 1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate is O=S(=O)(O[Te]12CCC[S+]1CCC2)C(F)(F)F.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate?
The InChIKey is TWPOFMTVQFJVCG-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H12F3O3S2Te.CHF3O3S/c8-7(9,10)15(11,12)13-16-5-1-3-14(16)4-2-6-16;2-1(3,4)8(5,6)7/h1-6H2;(H,5,6,7)/q+1;/p-1.
What are the key properties of 1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate?
1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate has a molecular weight of 541.97 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thionia-5λ4-tellurabicyclo[3.3.0]octan-5-yl trifluoromethanesulfonate;trifluoromethanesulfonate is sourced from PubChem (CID 139091438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).