C22H32O2Si — CID 11739790
(2R)-13-tri(propan-2-yl)silyltrideca-3,5,10,12-tetrayne-1,2-diol (PubChem CID 11739790) has the molecular formula C22H32O2Si and a molecular weight of 356.58 g/mol. Its IUPAC name is (2R)-13-tri(propan-2-yl)silyltrideca-3,5,10,12-tetrayne-1,2-diol.
| Compound Name | (2R)-13-tri(propan-2-yl)silyltrideca-3,5,10,12-tetrayne-1,2-diol |
|---|---|
| PubChem CID | 11739790 |
| Molecular Formula | C22H32O2Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (2R)-13-tri(propan-2-yl)silyltrideca-3,5,10,12-tetrayne-1,2-diol |
| SMILES | CC(C)[Si](C#CC#CCCCC#CC#C[C@@H](O)CO)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H32O2Si/c1-19(2)25(20(3)4,21(5)6)17-15-13-11-9-7-8-10-12-14-16-22(24)18-23/h19-24H,7-9,18H2,1-6H3/t22-/m1/s1 |
| InChIKey | NCEVCMKGBCUPEE-JOCHJYFZSA-N |
| XLogP | 3.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|