C18H27N2NaO2SSi — CID 11740881
sodium (4-methylphenyl)sulfonyl-[(E)-[(1R,4S,6S)-6-trimethylsilyl-2-bicyclo[2.2.2]octanylidene]amino]azanide (PubChem CID 11740881) has the molecular formula C18H27N2NaO2SSi and a molecular weight of 386.57 g/mol. Its IUPAC name is sodium (4-methylphenyl)sulfonyl-[(E)-[(1R,4S,6S)-6-trimethylsilyl-2-bicyclo[2.2.2]octanylidene]amino]azanide.
| Compound Name | sodium (4-methylphenyl)sulfonyl-[(E)-[(1R,4S,6S)-6-trimethylsilyl-2-bicyclo[2.2.2]octanylidene]amino]azanide |
|---|---|
| PubChem CID | 11740881 |
| Molecular Formula | C18H27N2NaO2SSi |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | sodium (4-methylphenyl)sulfonyl-[(E)-[(1R,4S,6S)-6-trimethylsilyl-2-bicyclo[2.2.2]octanylidene]amino]azanide |
| SMILES | Cc1ccc(S(=O)(=O)[N-]/N=C2\C[C@@H]3CC[C@H]2[C@@H]([Si](C)(C)C)C3)cc1.[Na+] |
| InChI | InChI=1S/C18H27N2O2SSi.Na/c1-13-5-8-15(9-6-13)23(21,22)20-19-17-11-14-7-10-16(17)18(12-14)24(2,3)4;/h5-6,8-9,14,16,18H,7,10-12H2,1-4H3;/q-1;+1/b19-17+;/t14-,16+,18-;/m0./s1 |
| InChIKey | YJXMUPZYPCEAJT-SOJCXUNYSA-N |
| XLogP | 1.95 |
| TPSA | 60.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|