C17H23N2NaO3S — CID 134877602
sodium [(E)-(4,4-dimethyl-1-oxaspiro[4.4]nonan-2-ylidene)amino]-(4-methylphenyl)sulfonylazanide (PubChem CID 134877602) has the molecular formula C17H23N2NaO3S and a molecular weight of 358.44 g/mol. Its IUPAC name is sodium [(E)-(4,4-dimethyl-1-oxaspiro[4.4]nonan-2-ylidene)amino]-(4-methylphenyl)sulfonylazanide.
| Compound Name | sodium [(E)-(4,4-dimethyl-1-oxaspiro[4.4]nonan-2-ylidene)amino]-(4-methylphenyl)sulfonylazanide |
|---|---|
| PubChem CID | 134877602 |
| Molecular Formula | C17H23N2NaO3S |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | sodium [(E)-(4,4-dimethyl-1-oxaspiro[4.4]nonan-2-ylidene)amino]-(4-methylphenyl)sulfonylazanide |
| SMILES | Cc1ccc(S(=O)(=O)[N-]/N=C2\CC(C)(C)C3(CCCC3)O2)cc1.[Na+] |
| InChI | InChI=1S/C17H23N2O3S.Na/c1-13-6-8-14(9-7-13)23(20,21)19-18-15-12-16(2,3)17(22-15)10-4-5-11-17;/h6-9H,4-5,10-12H2,1-3H3;/q-1;+1/b18-15+; |
| InChIKey | AGEACUDVIQTJBN-FLNCGGNMSA-N |
| XLogP | 1.13 |
| TPSA | 69.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|