C19H19N2NaO3S — CID 177427287
sodium (4-methylphenyl)sulfonyl-[(E)-[7-[(Z)-prop-1-enoxy]-2,3-dihydroinden-1-ylidene]amino]azanide (PubChem CID 177427287) has the molecular formula C19H19N2NaO3S and a molecular weight of 378.43 g/mol. Its IUPAC name is sodium (4-methylphenyl)sulfonyl-[(E)-[7-[(Z)-prop-1-enoxy]-2,3-dihydroinden-1-ylidene]amino]azanide.
| Compound Name | sodium (4-methylphenyl)sulfonyl-[(E)-[7-[(Z)-prop-1-enoxy]-2,3-dihydroinden-1-ylidene]amino]azanide |
|---|---|
| PubChem CID | 177427287 |
| Molecular Formula | C19H19N2NaO3S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | sodium (4-methylphenyl)sulfonyl-[(E)-[7-[(Z)-prop-1-enoxy]-2,3-dihydroinden-1-ylidene]amino]azanide |
| SMILES | C/C=C\Oc1cccc2c1/C(=N/[N-]S(=O)(=O)c1ccc(C)cc1)CC2.[Na+] |
| InChI | InChI=1S/C19H19N2O3S.Na/c1-3-13-24-18-6-4-5-15-9-12-17(19(15)18)20-21-25(22,23)16-10-7-14(2)8-11-16;/h3-8,10-11,13H,9,12H2,1-2H3;/q-1;+1/b13-3-,20-17+; |
| InChIKey | POGHIQJAWPXQIB-FZODIFQESA-N |
| XLogP | 1.32 |
| TPSA | 69.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|