C18H19NO4S — CID 57175041
[(2-methoxy-3,4-dihydronaphthalen-1-yl)amino] 4-methylbenzenesulfonate (PubChem CID 57175041) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is [(2-methoxy-3,4-dihydronaphthalen-1-yl)amino] 4-methylbenzenesulfonate.
| Compound Name | [(2-methoxy-3,4-dihydronaphthalen-1-yl)amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57175041 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [(2-methoxy-3,4-dihydronaphthalen-1-yl)amino] 4-methylbenzenesulfonate |
| SMILES | COC1=C(NOS(=O)(=O)c2ccc(C)cc2)c2ccccc2CC1 |
| InChI | InChI=1S/C18H19NO4S/c1-13-7-10-15(11-8-13)24(20,21)23-19-18-16-6-4-3-5-14(16)9-12-17(18)22-2/h3-8,10-11,19H,9,12H2,1-2H3 |
| InChIKey | ALEIGZNWSXZJGN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|