C21H19NO5S — CID 123834761
[(5-methoxy-2-methylbenzo[g][1]benzofuran-3-yl)amino] 4-methylbenzenesulfonate (PubChem CID 123834761) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is [(5-methoxy-2-methylbenzo[g][1]benzofuran-3-yl)amino] 4-methylbenzenesulfonate.
| Compound Name | [(5-methoxy-2-methylbenzo[g][1]benzofuran-3-yl)amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 123834761 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | [(5-methoxy-2-methylbenzo[g][1]benzofuran-3-yl)amino] 4-methylbenzenesulfonate |
| SMILES | COc1cc2c(NOS(=O)(=O)c3ccc(C)cc3)c(C)oc2c2ccccc12 |
| InChI | InChI=1S/C21H19NO5S/c1-13-8-10-15(11-9-13)28(23,24)27-22-20-14(2)26-21-17-7-5-4-6-16(17)19(25-3)12-18(20)21/h4-12,22H,1-3H3 |
| InChIKey | JEITYRNVTLJRHI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|