methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate

C15H16O5 — CID 117442178

IUPACmethyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate
SMILESCOC(=O)C(O)c1c(OC)ccc2ccc(OC)cc12
InChIInChI=1S/C15H16O5/c1-18-10-6-4-9-5-7-12(19-2)13(11(9)8-10)14(16)15(17)20-3/h4-8,14,16H,1-3H3
InChIKeyLHGOFODWNLSSCV-UHFFFAOYSA-N
MW276.29 g/mol
LogP2.06
Rot. Bonds4

About methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate

methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate (PubChem CID 117442178) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate.

Molecular Properties

Compound Namemethyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate
PubChem CID117442178
Molecular FormulaC15H16O5
Molecular Weight276.29 g/mol
Exact Mass276.10
IUPAC Namemethyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate
SMILESCOC(=O)C(O)c1c(OC)ccc2ccc(OC)cc12
InChIInChI=1S/C15H16O5/c1-18-10-6-4-9-5-7-12(19-2)13(11(9)8-10)14(16)15(17)20-3/h4-8,14,16H,1-3H3
InChIKeyLHGOFODWNLSSCV-UHFFFAOYSA-N
XLogP2.06
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.29
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate?
The IUPAC name of methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate (CID 117442178) is methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate.
What is the SMILES notation for methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate?
The canonical SMILES for methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate is COC(=O)C(O)c1c(OC)ccc2ccc(OC)cc12.
What is the InChIKey of methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate?
The InChIKey is LHGOFODWNLSSCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O5/c1-18-10-6-4-9-5-7-12(19-2)13(11(9)8-10)14(16)15(17)20-3/h4-8,14,16H,1-3H3.
What are the key properties of methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate?
methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate has a molecular weight of 276.29 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,7-dimethoxynaphthalen-1-yl)-2-hydroxyacetate is sourced from PubChem (CID 117442178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).