C15H14F2O3 — CID 117449707
1-(5,7-difluoro-1-benzofuran-4-yl)cyclohexane-1-carboxylic acid (PubChem CID 117449707) has the molecular formula C15H14F2O3 and a molecular weight of 280.27 g/mol. Its IUPAC name is 1-(5,7-difluoro-1-benzofuran-4-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(5,7-difluoro-1-benzofuran-4-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117449707 |
| Molecular Formula | C15H14F2O3 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-(5,7-difluoro-1-benzofuran-4-yl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2c(F)cc(F)c3occc23)CCCCC1 |
| InChI | InChI=1S/C15H14F2O3/c16-10-8-11(17)13-9(4-7-20-13)12(10)15(14(18)19)5-2-1-3-6-15/h4,7-8H,1-3,5-6H2,(H,18,19) |
| InChIKey | GAXMYXPTJVPUKY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |