C12H19F3S2 — CID 11748088
2-(1-cyclohexyl-2,2,2-trifluoroethyl)-1,3-dithiane (PubChem CID 11748088) has the molecular formula C12H19F3S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is 2-(1-cyclohexyl-2,2,2-trifluoroethyl)-1,3-dithiane.
| Compound Name | 2-(1-cyclohexyl-2,2,2-trifluoroethyl)-1,3-dithiane |
|---|---|
| PubChem CID | 11748088 |
| Molecular Formula | C12H19F3S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-(1-cyclohexyl-2,2,2-trifluoroethyl)-1,3-dithiane |
| SMILES | FC(F)(F)C(C1CCCCC1)C1SCCCS1 |
| InChI | InChI=1S/C12H19F3S2/c13-12(14,15)10(9-5-2-1-3-6-9)11-16-7-4-8-17-11/h9-11H,1-8H2 |
| InChIKey | MDAUGTGNILJKQI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |