C11H9ClF4O3 — CID 117484315
2-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)propan-2-ol (PubChem CID 117484315) has the molecular formula C11H9ClF4O3 and a molecular weight of 300.64 g/mol. Its IUPAC name is 2-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)propan-2-ol.
| Compound Name | 2-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)propan-2-ol |
|---|---|
| PubChem CID | 117484315 |
| Molecular Formula | C11H9ClF4O3 |
| Molecular Weight | 300.64 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)propan-2-ol |
| SMILES | CC(C)(O)c1cc2c(cc1Cl)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C11H9ClF4O3/c1-9(2,17)5-3-7-8(4-6(5)12)19-11(15,16)10(13,14)18-7/h3-4,17H,1-2H3 |
| InChIKey | ATVRCIJPCGEAIY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|