C12H10ClF4NO2 — CID 117496383
1-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)cyclobutan-1-amine (PubChem CID 117496383) has the molecular formula C12H10ClF4NO2 and a molecular weight of 311.66 g/mol. Its IUPAC name is 1-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)cyclobutan-1-amine.
| Compound Name | 1-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 117496383 |
| Molecular Formula | C12H10ClF4NO2 |
| Molecular Weight | 311.66 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 1-(6-chloro-2,2,3,3-tetrafluoro-1,4-benzodioxin-7-yl)cyclobutan-1-amine |
| SMILES | NC1(c2cc3c(cc2Cl)OC(F)(F)C(F)(F)O3)CCC1 |
| InChI | InChI=1S/C12H10ClF4NO2/c13-7-5-9-8(4-6(7)10(18)2-1-3-10)19-11(14,15)12(16,17)20-9/h4-5H,1-3,18H2 |
| InChIKey | XKUDAPZSOTVAQJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.66 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|