C15H19BrO2 — CID 117496036
3-(4-bromo-3-hydroxy-1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)butanal (PubChem CID 117496036) has the molecular formula C15H19BrO2 and a molecular weight of 311.22 g/mol. Its IUPAC name is 3-(4-bromo-3-hydroxy-1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)butanal.
| Compound Name | 3-(4-bromo-3-hydroxy-1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)butanal |
|---|---|
| PubChem CID | 117496036 |
| Molecular Formula | C15H19BrO2 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 3-(4-bromo-3-hydroxy-1-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)butanal |
| SMILES | Cc1c2c(c(Br)c(O)c1C(C)CC=O)CCCC2 |
| InChI | InChI=1S/C15H19BrO2/c1-9(7-8-17)13-10(2)11-5-3-4-6-12(11)14(16)15(13)18/h8-9,18H,3-7H2,1-2H3 |
| InChIKey | JXVAYLHKXMZANN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|