C14H23N3O9P2 — CID 11751003
[(4aR,6R,7aS)-2-oxo-6-(2-oxopyrimidin-1-yl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 11751003) has the molecular formula C14H23N3O9P2 and a molecular weight of 439.30 g/mol. Its IUPAC name is [(4aR,6R,7aS)-2-oxo-6-(2-oxopyrimidin-1-yl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(4aR,6R,7aS)-2-oxo-6-(2-oxopyrimidin-1-yl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 11751003 |
| Molecular Formula | C14H23N3O9P2 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | [(4aR,6R,7aS)-2-oxo-6-(2-oxopyrimidin-1-yl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OP1(=O)OC[C@H]2O[C@@H](n3cccnc3=O)C[C@@H]2O1 |
| InChI | InChI=1S/C14H23N3O9P2/c1-17(2,3)7-8-22-27(19,20)26-28(21)23-10-12-11(25-28)9-13(24-12)16-6-4-5-15-14(16)18/h4-6,11-13H,7-10H2,1-3H3/t11-,12+,13+,28?/m0/s1 |
| InChIKey | PWIDEAKAFJKEGK-QDSMQDDISA-N |
| XLogP | 0.26 |
| TPSA | 138.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|