C23H39NO9 — CID 11754610
[(2R,3R,4R,5S)-3,4,5-triacetyloxy-1-(6-propoxyhexyl)piperidin-2-yl]methyl acetate (PubChem CID 11754610) has the molecular formula C23H39NO9 and a molecular weight of 473.56 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4,5-triacetyloxy-1-(6-propoxyhexyl)piperidin-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-3,4,5-triacetyloxy-1-(6-propoxyhexyl)piperidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11754610 |
| Molecular Formula | C23H39NO9 |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-triacetyloxy-1-(6-propoxyhexyl)piperidin-2-yl]methyl acetate |
| SMILES | CCCOCCCCCCN1C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1COC(C)=O |
| InChI | InChI=1S/C23H39NO9/c1-6-12-29-13-10-8-7-9-11-24-14-21(31-17(3)26)23(33-19(5)28)22(32-18(4)27)20(24)15-30-16(2)25/h20-23H,6-15H2,1-5H3/t20-,21+,22-,23-/m1/s1 |
| InChIKey | GXQPPIYXIZTUBL-KAOXLYBCSA-N |
| XLogP | 2.02 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|