C31H52N2O9 — CID 123325048
[3,4,5-triacetyloxy-1-[6-[cyclohexyl(2,2-dimethylpropanoyl)amino]hexyl]piperidin-2-yl]methyl acetate (PubChem CID 123325048) has the molecular formula C31H52N2O9 and a molecular weight of 596.76 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-1-[6-[cyclohexyl(2,2-dimethylpropanoyl)amino]hexyl]piperidin-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-1-[6-[cyclohexyl(2,2-dimethylpropanoyl)amino]hexyl]piperidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 123325048 |
| Molecular Formula | C31H52N2O9 |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.37 |
| IUPAC Name | [3,4,5-triacetyloxy-1-[6-[cyclohexyl(2,2-dimethylpropanoyl)amino]hexyl]piperidin-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)CN1CCCCCCN(C(=O)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C31H52N2O9/c1-21(34)39-20-26-28(41-23(3)36)29(42-24(4)37)27(40-22(2)35)19-32(26)17-13-8-9-14-18-33(30(38)31(5,6)7)25-15-11-10-12-16-25/h25-29H,8-20H2,1-7H3 |
| InChIKey | UFETXVLPYRCEML-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|