C15H19AtN4O2S — CID 11756738
[5-[4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butylcarbamoyl]-3-pyridinyl]astatine (PubChem CID 11756738) has the molecular formula C15H19AtN4O2S and a molecular weight of 529.41 g/mol. Its IUPAC name is [5-[4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butylcarbamoyl]-3-pyridinyl]astatine.
| Compound Name | [5-[4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butylcarbamoyl]-3-pyridinyl]astatine |
|---|---|
| PubChem CID | 11756738 |
| Molecular Formula | C15H19AtN4O2S |
| Molecular Weight | 529.41 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | [5-[4-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)butylcarbamoyl]-3-pyridinyl]astatine |
| SMILES | O=C1NC2CSC(CCCCNC(=O)c3cncc([At])c3)C2N1 |
| InChI | InChI=1S/C15H19AtN4O2S/c16-10-5-9(6-17-7-10)14(21)18-4-2-1-3-12-13-11(8-23-12)19-15(22)20-13/h5-7,11-13H,1-4,8H2,(H,18,21)(H2,19,20,22) |
| InChIKey | HRFZQQKWSLAMSR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|