C19H15NO4 — CID 11759046
ethyl 4,5-dioxo-1,2-diphenylpyrrole-3-carboxylate (PubChem CID 11759046) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is ethyl 4,5-dioxo-1,2-diphenylpyrrole-3-carboxylate.
| Compound Name | ethyl 4,5-dioxo-1,2-diphenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 11759046 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | ethyl 4,5-dioxo-1,2-diphenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N(c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C19H15NO4/c1-2-24-19(23)15-16(13-9-5-3-6-10-13)20(18(22)17(15)21)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| InChIKey | HFBUKTPIXNYCMH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|