C28H60O5Si3 — CID 11766897
(2R,3S)-3-[(2R,4S,6S)-2,4,6-tris[[tert-butyl(dimethyl)silyl]oxy]heptyl]oxirane-2-carbaldehyde (PubChem CID 11766897) has the molecular formula C28H60O5Si3 and a molecular weight of 561.04 g/mol. Its IUPAC name is (2R,3S)-3-[(2R,4S,6S)-2,4,6-tris[[tert-butyl(dimethyl)silyl]oxy]heptyl]oxirane-2-carbaldehyde.
| Compound Name | (2R,3S)-3-[(2R,4S,6S)-2,4,6-tris[[tert-butyl(dimethyl)silyl]oxy]heptyl]oxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 11766897 |
| Molecular Formula | C28H60O5Si3 |
| Molecular Weight | 561.04 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | (2R,3S)-3-[(2R,4S,6S)-2,4,6-tris[[tert-butyl(dimethyl)silyl]oxy]heptyl]oxirane-2-carbaldehyde |
| SMILES | C[C@@H](C[C@@H](C[C@@H](C[C@@H]1O[C@H]1C=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H60O5Si3/c1-21(31-34(11,12)26(2,3)4)17-22(32-35(13,14)27(5,6)7)18-23(19-24-25(20-29)30-24)33-36(15,16)28(8,9)10/h20-25H,17-19H2,1-16H3/t21-,22-,23-,24-,25-/m0/s1 |
| InChIKey | RDIQZTTYKBQIPH-KEOOTSPTSA-N |
| XLogP | 8.31 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.04 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|