C27H35NO3 — CID 11774513
[(Z,3R)-5,5-dimethyl-4-oxo-1,3-diphenylhex-1-enyl] N,N-di(propan-2-yl)carbamate (PubChem CID 11774513) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is [(Z,3R)-5,5-dimethyl-4-oxo-1,3-diphenylhex-1-enyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(Z,3R)-5,5-dimethyl-4-oxo-1,3-diphenylhex-1-enyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 11774513 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | [(Z,3R)-5,5-dimethyl-4-oxo-1,3-diphenylhex-1-enyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)O/C(=C\[C@@H](C(=O)C(C)(C)C)c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C27H35NO3/c1-19(2)28(20(3)4)26(30)31-24(22-16-12-9-13-17-22)18-23(25(29)27(5,6)7)21-14-10-8-11-15-21/h8-20,23H,1-7H3/b24-18-/t23-/m1/s1 |
| InChIKey | FELDHNFJBSPYTN-OXONHODOSA-N |
| XLogP | 6.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|