C14H14N4O2S — CID 11781617
3-(3-methylbut-2-enoylamino)-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide (PubChem CID 11781617) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-(3-methylbut-2-enoylamino)-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide.
| Compound Name | 3-(3-methylbut-2-enoylamino)-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11781617 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-(3-methylbut-2-enoylamino)-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide |
| SMILES | CC(C)=CC(=O)Nc1cccnc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C14H14N4O2S/c1-9(2)8-11(19)17-10-4-3-5-15-12(10)13(20)18-14-16-6-7-21-14/h3-8H,1-2H3,(H,17,19)(H,16,18,20) |
| InChIKey | UJQGJJURAWVPHK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|