C20H30O2S — CID 11782607
1-[(1S,2S)-2-methoxy-2-[(2R)-2-methoxypent-4-enyl]cyclohexyl]sulfanyl-4-methylbenzene (PubChem CID 11782607) has the molecular formula C20H30O2S and a molecular weight of 334.53 g/mol. Its IUPAC name is 1-[(1S,2S)-2-methoxy-2-[(2R)-2-methoxypent-4-enyl]cyclohexyl]sulfanyl-4-methylbenzene.
| Compound Name | 1-[(1S,2S)-2-methoxy-2-[(2R)-2-methoxypent-4-enyl]cyclohexyl]sulfanyl-4-methylbenzene |
|---|---|
| PubChem CID | 11782607 |
| Molecular Formula | C20H30O2S |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-[(1S,2S)-2-methoxy-2-[(2R)-2-methoxypent-4-enyl]cyclohexyl]sulfanyl-4-methylbenzene |
| SMILES | C=CC[C@H](C[C@@]1(OC)CCCC[C@@H]1Sc1ccc(C)cc1)OC |
| InChI | InChI=1S/C20H30O2S/c1-5-8-17(21-3)15-20(22-4)14-7-6-9-19(20)23-18-12-10-16(2)11-13-18/h5,10-13,17,19H,1,6-9,14-15H2,2-4H3/t17-,19+,20+/m1/s1 |
| InChIKey | MDULECVYBFTBLH-HOJAQTOUSA-N |
| XLogP | 5.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|