C23H19NO3 — CID 11783265
1-[2-[(E)-N-hydroxy-C-(4-methylphenyl)carbonimidoyl]phenyl]-3-phenylpropane-1,3-dione (PubChem CID 11783265) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-[2-[(E)-N-hydroxy-C-(4-methylphenyl)carbonimidoyl]phenyl]-3-phenylpropane-1,3-dione.
| Compound Name | 1-[2-[(E)-N-hydroxy-C-(4-methylphenyl)carbonimidoyl]phenyl]-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 11783265 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-[2-[(E)-N-hydroxy-C-(4-methylphenyl)carbonimidoyl]phenyl]-3-phenylpropane-1,3-dione |
| SMILES | Cc1ccc(/C(=N\O)c2ccccc2C(=O)CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO3/c1-16-11-13-18(14-12-16)23(24-27)20-10-6-5-9-19(20)22(26)15-21(25)17-7-3-2-4-8-17/h2-14,27H,15H2,1H3/b24-23+ |
| InChIKey | WFKKDZJHFHIJNU-WCWDXBQESA-N |
| XLogP | 4.68 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|