C20H28O5S — CID 11783835
2-(benzenesulfonyl)-1-[(4R,5S,6S)-2,2,5-trimethyl-6-(3-methylbut-2-enyl)-1,3-dioxan-4-yl]ethanone (PubChem CID 11783835) has the molecular formula C20H28O5S and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-[(4R,5S,6S)-2,2,5-trimethyl-6-(3-methylbut-2-enyl)-1,3-dioxan-4-yl]ethanone.
| Compound Name | 2-(benzenesulfonyl)-1-[(4R,5S,6S)-2,2,5-trimethyl-6-(3-methylbut-2-enyl)-1,3-dioxan-4-yl]ethanone |
|---|---|
| PubChem CID | 11783835 |
| Molecular Formula | C20H28O5S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-(benzenesulfonyl)-1-[(4R,5S,6S)-2,2,5-trimethyl-6-(3-methylbut-2-enyl)-1,3-dioxan-4-yl]ethanone |
| SMILES | CC(C)=CC[C@@H]1OC(C)(C)O[C@@H](C(=O)CS(=O)(=O)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C20H28O5S/c1-14(2)11-12-18-15(3)19(25-20(4,5)24-18)17(21)13-26(22,23)16-9-7-6-8-10-16/h6-11,15,18-19H,12-13H2,1-5H3/t15-,18-,19+/m0/s1 |
| InChIKey | GOXMLIZWWAYHIF-ZYSHUDEJSA-N |
| XLogP | 3.54 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|